| Name | Ramosetron Hydrochloride |
| Synonyms | RAMOSETRON HCL Ramosetron HCl (r)-monohydrochlorid RAMOSETRON HYDROCHLORIDE Ramosetron Hydrochloride (1-methyl-1h-indol-3-yl)(4,5,6,7-tetrahydro-1h-benzimidazol-5-yl)-methanon (r)-5-((1-methyl-3-indolyl)carbonyl)-4,5,6,7-tetrahydro-1h-benzimidazolehydr (R)-5-[(1-Methyl-3-indolyl)carbonyl]-4,5,6,7-tetrahydro-1H-benzimidazole hydrochloride (1-methylindol-3-yl)-[(5r)-4,5,6,7-tetrahydro-3h-benzimidazol-5-yl]methanone hydrochloride |
| CAS | 132907-72-3 |
| InChI | InChI=1/C17H17N3O.ClH/c1-20-9-13(12-4-2-3-5-16(12)20)17(21)11-6-7-14-15(8-11)19-10-18-14;/h2-5,9-11H,6-8H2,1H3,(H,18,19);1H/t11-;/m1./s1 |
| InChIKey | XIXYTCLDXQRHJO-RFVHGSKJSA-N |
| Molecular Formula | C17H18ClN3O |
| Molar Mass | 315.8 |
| Melting Point | 244-246°C |
| Boling Point | 579.7°C at 760 mmHg |
| Specific Rotation(α) | D -42.9° (c 1.02 in methanol) |
| Flash Point | 304.4°C |
| Solubility | H2O: soluble20mg/mL, clear |
| Vapor Presure | 1.96E-13mmHg at 25°C |
| Appearance | White-like powder |
| Color | white to beige |
| Storage Condition | -20°C |
| Stability | Hygroscopic |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| WGK Germany | 3 |
| Reference Show more | 1. [IF=2.967] Liqun Zhao et al."Application of dexmedetomidine combined with sufentanil in colon cancer resection and its effect on immune and coagulation function of patients."Oncol Lett. 2020 Aug;20(2):1288-1294 |